Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Category: isothiazole, 2107-69-9, Name is 5,6-Dimethoxy-2,3-dihydro-1H-inden-1-one, SMILES is C1=C2C(=CC(=C1OC)OC)C(CC2)=O, belongs to isothiazole compound. In a document, author is TARI, LW, introduce the new discover.
STRUCTURE OF 5-(1-METHYL-2,1-BENZISOTHIAZOL-3-YLIDENEAMINO)-2,4-PENTADIENAL
C13H12N2OS, M(r) = 244.31, monoclinic, P2(1)/a, a = 7.743 (2), b = 12.430 (5), c = 12.776 (5) angstrom, beta = 90.52 (3)-degrees, V = 1229.6 (7) angstrom 3, Z = 4, D(x) = 1.32 Mg m-3, lambda(Mo K-alpha) = 0.71069 angstrom, graphite monochromator, mu = 0.236 mm-1, F(000) = 512, T = 295 K, R = 0.040, wR = 0.049 for 2958 independent reflections collected. This is only the third example of a crystal structure containing a 2,1-benzisothiazole ring system. Bond lengths in the isothiazole ring of the title compound suggest much less double-bond character than observed in the other two known structures. The molecule is essentially planar and packs in the crystal with the benzisothiazole rings stacked in the [100] direction.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 2107-69-9. Category: isothiazole.
Reference:
Isothiazole – Wikipedia,
,Isothiazole – ScienceDirect.com